C7H16O6S2 — CID 174850262
1-O-methyl 1-O'-propyl propane-1,1-disulfonate (PubChem CID 174850262) has the molecular formula C7H16O6S2 and a molecular weight of 260.33 g/mol. Its IUPAC name is 1-O-methyl 1-O'-propyl propane-1,1-disulfonate.
| Compound Name | 1-O-methyl 1-O'-propyl propane-1,1-disulfonate |
|---|---|
| PubChem CID | 174850262 |
| Molecular Formula | C7H16O6S2 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-O-methyl 1-O'-propyl propane-1,1-disulfonate |
| SMILES | CCCOS(=O)(=O)C(CC)S(=O)(=O)OC |
| InChI | InChI=1S/C7H16O6S2/c1-4-6-13-15(10,11)7(5-2)14(8,9)12-3/h7H,4-6H2,1-3H3 |
| InChIKey | MXZZOGJUWBEAFG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|