C13H28O11S4 — CID 122600077
1-O-(1-methylsulfonylethyl) 5-O-(1-propoxysulfonylethyl) pentane-1,5-disulfonate (PubChem CID 122600077) has the molecular formula C13H28O11S4 and a molecular weight of 488.62 g/mol. Its IUPAC name is 1-O-(1-methylsulfonylethyl) 5-O-(1-propoxysulfonylethyl) pentane-1,5-disulfonate.
| Compound Name | 1-O-(1-methylsulfonylethyl) 5-O-(1-propoxysulfonylethyl) pentane-1,5-disulfonate |
|---|---|
| PubChem CID | 122600077 |
| Molecular Formula | C13H28O11S4 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 1-O-(1-methylsulfonylethyl) 5-O-(1-propoxysulfonylethyl) pentane-1,5-disulfonate |
| SMILES | CCCOS(=O)(=O)C(C)OS(=O)(=O)CCCCCS(=O)(=O)OC(C)S(C)(=O)=O |
| InChI | InChI=1S/C13H28O11S4/c1-5-9-22-28(20,21)13(3)24-27(18,19)11-8-6-7-10-26(16,17)23-12(2)25(4,14)15/h12-13H,5-11H2,1-4H3 |
| InChIKey | UVRYBGYOLDMBPT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|