C12H26O11S4 — CID 122600158
1-O-(1-methylsulfonylethyl) 4-O-(1-propan-2-yloxysulfonylethyl) butane-1,4-disulfonate (PubChem CID 122600158) has the molecular formula C12H26O11S4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 1-O-(1-methylsulfonylethyl) 4-O-(1-propan-2-yloxysulfonylethyl) butane-1,4-disulfonate.
| Compound Name | 1-O-(1-methylsulfonylethyl) 4-O-(1-propan-2-yloxysulfonylethyl) butane-1,4-disulfonate |
|---|---|
| PubChem CID | 122600158 |
| Molecular Formula | C12H26O11S4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 1-O-(1-methylsulfonylethyl) 4-O-(1-propan-2-yloxysulfonylethyl) butane-1,4-disulfonate |
| SMILES | CC(C)OS(=O)(=O)C(C)OS(=O)(=O)CCCCS(=O)(=O)OC(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H26O11S4/c1-10(2)21-27(19,20)12(4)23-26(17,18)9-7-6-8-25(15,16)22-11(3)24(5,13)14/h10-12H,6-9H2,1-5H3 |
| InChIKey | UJFVZIKPKFBEFE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|