About 3-methylbutan-2-yl pentane-1-sulfonate
3-methylbutan-2-yl pentane-1-sulfonate (PubChem CID 89438992) has the molecular formula C10H22O3S
and a molecular weight of 222.35 g/mol. Its IUPAC name is 3-methylbutan-2-yl pentane-1-sulfonate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl pentane-1-sulfonate |
| PubChem CID | 89438992 |
| Molecular Formula | C10H22O3S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-methylbutan-2-yl pentane-1-sulfonate |
| SMILES | CCCCCS(=O)(=O)OC(C)C(C)C |
| InChI | InChI=1S/C10H22O3S/c1-5-6-7-8-14(11,12)13-10(4)9(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | QNDVDDVBLDPTLS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl pentane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl pentane-1-sulfonate?
The IUPAC name of 3-methylbutan-2-yl pentane-1-sulfonate (CID 89438992) is 3-methylbutan-2-yl pentane-1-sulfonate.
What is the SMILES notation for 3-methylbutan-2-yl pentane-1-sulfonate?
The canonical SMILES for 3-methylbutan-2-yl pentane-1-sulfonate is CCCCCS(=O)(=O)OC(C)C(C)C.
What is the InChIKey of 3-methylbutan-2-yl pentane-1-sulfonate?
The InChIKey is QNDVDDVBLDPTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3S/c1-5-6-7-8-14(11,12)13-10(4)9(2)3/h9-10H,5-8H2,1-4H3.
What are the key properties of 3-methylbutan-2-yl pentane-1-sulfonate?
3-methylbutan-2-yl pentane-1-sulfonate has a molecular weight of 222.35 g/mol, XLogP of 2.57, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl pentane-1-sulfonate is sourced from PubChem (CID 89438992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).