C10H13N3O2S — CID 174852126
1-(benzylideneamino)-1,3-dimethoxythiourea (PubChem CID 174852126) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-(benzylideneamino)-1,3-dimethoxythiourea.
| Compound Name | 1-(benzylideneamino)-1,3-dimethoxythiourea |
|---|---|
| PubChem CID | 174852126 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-(benzylideneamino)-1,3-dimethoxythiourea |
| SMILES | CONC(=S)N(N=Cc1ccccc1)OC |
| InChI | InChI=1S/C10H13N3O2S/c1-14-12-10(16)13(15-2)11-8-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,12,16) |
| InChIKey | MPGGRCLBMWAABB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|