1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid

C13H18N2O2 — CID 174852195

IUPAC1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid
SMILESCc1cc(C)cc(C(C)C)c1.N=C=O.N=C=O
InChIInChI=1S/C11H16.2CHNO/c1-8(2)11-6-9(3)5-10(4)7-11;2*2-1-3/h5-8H,1-4H3;2*2H
InChIKeyXHYFNAUCQHENMH-UHFFFAOYSA-N
MW234.30 g/mol
LogP3.23
Rot. Bonds1

About 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid

1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid (PubChem CID 174852195) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid.

Molecular Properties

Compound Name1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid
PubChem CID174852195
Molecular FormulaC13H18N2O2
Molecular Weight234.30 g/mol
Exact Mass234.14
IUPAC Name1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid
SMILESCc1cc(C)cc(C(C)C)c1.N=C=O.N=C=O
InChIInChI=1S/C11H16.2CHNO/c1-8(2)11-6-9(3)5-10(4)7-11;2*2-1-3/h5-8H,1-4H3;2*2H
InChIKeyXHYFNAUCQHENMH-UHFFFAOYSA-N
XLogP3.23
TPSA81.84 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.30
LogP ≤ 53.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid?
The IUPAC name of 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid (CID 174852195) is 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid.
What is the SMILES notation for 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid?
The canonical SMILES for 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid is Cc1cc(C)cc(C(C)C)c1.N=C=O.N=C=O.
What is the InChIKey of 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid?
The InChIKey is XHYFNAUCQHENMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.2CHNO/c1-8(2)11-6-9(3)5-10(4)7-11;2*2-1-3/h5-8H,1-4H3;2*2H.
What are the key properties of 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid?
1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid has a molecular weight of 234.30 g/mol, XLogP of 3.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-propan-2-ylbenzene;isocyanic acid is sourced from PubChem (CID 174852195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).