C16H25N3O4 — CID 174852709
tert-butyl 2-methylpiperazine-1-carboxylate;pyridine-2-carboxylic acid (PubChem CID 174852709) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl 2-methylpiperazine-1-carboxylate;pyridine-2-carboxylic acid.
| Compound Name | tert-butyl 2-methylpiperazine-1-carboxylate;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 174852709 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl 2-methylpiperazine-1-carboxylate;pyridine-2-carboxylic acid |
| SMILES | CC1CNCCN1C(=O)OC(C)(C)C.O=C(O)c1ccccn1 |
| InChI | InChI=1S/C10H20N2O2.C6H5NO2/c1-8-7-11-5-6-12(8)9(13)14-10(2,3)4;8-6(9)5-3-1-2-4-7-5/h8,11H,5-7H2,1-4H3;1-4H,(H,8,9) |
| InChIKey | AIAFSZMTGKSRFF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |