tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride

C11H21ClN2O4 — CID 175306279

IUPACtert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride
SMILESCC(C)(C)OC(=O)O.CC1CNCCN1C(=O)Cl
InChIInChI=1S/C6H11ClN2O.C5H10O3/c1-5-4-8-2-3-9(5)6(7)10;1-5(2,3)8-4(6)7/h5,8H,2-4H2,1H3;1-3H3,(H,6,7)
InChIKeyYVEPHCGECNQAFH-UHFFFAOYSA-N
MW280.75 g/mol
LogP2.12
Rot. Bonds

About tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride

tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride (PubChem CID 175306279) has the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. Its IUPAC name is tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride.

Molecular Properties

Compound Nametert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride
PubChem CID175306279
Molecular FormulaC11H21ClN2O4
Molecular Weight280.75 g/mol
Exact Mass280.12
IUPAC Nametert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride
SMILESCC(C)(C)OC(=O)O.CC1CNCCN1C(=O)Cl
InChIInChI=1S/C6H11ClN2O.C5H10O3/c1-5-4-8-2-3-9(5)6(7)10;1-5(2,3)8-4(6)7/h5,8H,2-4H2,1H3;1-3H3,(H,6,7)
InChIKeyYVEPHCGECNQAFH-UHFFFAOYSA-N
XLogP2.12
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.75
LogP ≤ 52.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride?
The IUPAC name of tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride (CID 175306279) is tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride.
What is the SMILES notation for tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride?
The canonical SMILES for tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride is CC(C)(C)OC(=O)O.CC1CNCCN1C(=O)Cl.
What is the InChIKey of tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride?
The InChIKey is YVEPHCGECNQAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClN2O.C5H10O3/c1-5-4-8-2-3-9(5)6(7)10;1-5(2,3)8-4(6)7/h5,8H,2-4H2,1H3;1-3H3,(H,6,7).
What are the key properties of tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride?
tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride has a molecular weight of 280.75 g/mol, XLogP of 2.12, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl hydrogen carbonate;2-methylpiperazine-1-carbonyl chloride is sourced from PubChem (CID 175306279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).