C35H38O7S2 — CID 174854090
1,5-bis[4-(4-methoxyphenyl)sulfonyl-3,5-dimethylphenyl]pentan-3-one (PubChem CID 174854090) has the molecular formula C35H38O7S2 and a molecular weight of 634.82 g/mol. Its IUPAC name is 1,5-bis[4-(4-methoxyphenyl)sulfonyl-3,5-dimethylphenyl]pentan-3-one.
| Compound Name | 1,5-bis[4-(4-methoxyphenyl)sulfonyl-3,5-dimethylphenyl]pentan-3-one |
|---|---|
| PubChem CID | 174854090 |
| Molecular Formula | C35H38O7S2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | 1,5-bis[4-(4-methoxyphenyl)sulfonyl-3,5-dimethylphenyl]pentan-3-one |
| SMILES | COc1ccc(S(=O)(=O)c2c(C)cc(CCC(=O)CCc3cc(C)c(S(=O)(=O)c4ccc(OC)cc4)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C35H38O7S2/c1-23-19-27(20-24(2)34(23)43(37,38)32-15-11-30(41-5)12-16-32)7-9-29(36)10-8-28-21-25(3)35(26(4)22-28)44(39,40)33-17-13-31(42-6)14-18-33/h11-22H,7-10H2,1-6H3 |
| InChIKey | MJEXNSKNHSTNFG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |