C27H41P — CID 174856843
[3-hexyl-5-phenyl-2,4,6-tri(propan-2-yl)phenyl]phosphane (PubChem CID 174856843) has the molecular formula C27H41P and a molecular weight of 396.60 g/mol. Its IUPAC name is [3-hexyl-5-phenyl-2,4,6-tri(propan-2-yl)phenyl]phosphane.
| Compound Name | [3-hexyl-5-phenyl-2,4,6-tri(propan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 174856843 |
| Molecular Formula | C27H41P |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | [3-hexyl-5-phenyl-2,4,6-tri(propan-2-yl)phenyl]phosphane |
| SMILES | CCCCCCc1c(C(C)C)c(P)c(C(C)C)c(-c2ccccc2)c1C(C)C |
| InChI | InChI=1S/C27H41P/c1-8-9-10-14-17-22-23(18(2)3)26(21-15-12-11-13-16-21)25(20(6)7)27(28)24(22)19(4)5/h11-13,15-16,18-20H,8-10,14,17,28H2,1-7H3 |
| InChIKey | CEYBWKSHUWIUEZ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|