C30H38 — CID 123884738
1,3-di(butan-2-yl)-4-butyl-2,5-diphenylbenzene (PubChem CID 123884738) has the molecular formula C30H38 and a molecular weight of 398.63 g/mol. Its IUPAC name is 1,3-di(butan-2-yl)-4-butyl-2,5-diphenylbenzene.
| Compound Name | 1,3-di(butan-2-yl)-4-butyl-2,5-diphenylbenzene |
|---|---|
| PubChem CID | 123884738 |
| Molecular Formula | C30H38 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 1,3-di(butan-2-yl)-4-butyl-2,5-diphenylbenzene |
| SMILES | CCCCc1c(-c2ccccc2)cc(C(C)CC)c(-c2ccccc2)c1C(C)CC |
| InChI | InChI=1S/C30H38/c1-6-9-20-26-28(24-16-12-10-13-17-24)21-27(22(4)7-2)30(29(26)23(5)8-3)25-18-14-11-15-19-25/h10-19,21-23H,6-9,20H2,1-5H3 |
| InChIKey | OYYZUBVNFWYDFY-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |