C24H34 — CID 123827327
1,3-di(butan-2-yl)-2-methyl-4-phenyl-5-propylbenzene (PubChem CID 123827327) has the molecular formula C24H34 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1,3-di(butan-2-yl)-2-methyl-4-phenyl-5-propylbenzene.
| Compound Name | 1,3-di(butan-2-yl)-2-methyl-4-phenyl-5-propylbenzene |
|---|---|
| PubChem CID | 123827327 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1,3-di(butan-2-yl)-2-methyl-4-phenyl-5-propylbenzene |
| SMILES | CCCc1cc(C(C)CC)c(C)c(C(C)CC)c1-c1ccccc1 |
| InChI | InChI=1S/C24H34/c1-7-13-21-16-22(17(4)8-2)19(6)23(18(5)9-3)24(21)20-14-11-10-12-15-20/h10-12,14-18H,7-9,13H2,1-6H3 |
| InChIKey | FESGXZJNASWBLE-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |