About 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate
6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate (PubChem CID 174857141) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate.
Analyze 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate?
The IUPAC name of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate (CID 174857141) is 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate.
What is the SMILES notation for 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate?
The canonical SMILES for 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate is CC(C)(C)OC(=O)O.c1cc2nc-2c1.
What is the InChIKey of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate?
The InChIKey is ZQUBJRKRQBMOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N.C5H10O3/c1-2-4-5(3-1)6-4;1-5(2,3)8-4(6)7/h1-3H;1-3H3,(H,6,7).
What are the key properties of 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate?
6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate has a molecular weight of 195.22 g/mol, XLogP of 2.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.1.0]hexa-1(6),2,4-triene;tert-butyl hydrogen carbonate is sourced from PubChem (CID 174857141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).