C12H23NO5 — CID 174857893
(2S)-2-amino-4-methylpentanoic acid;methyl 3-hydroxy-2-methylidenebutanoate (PubChem CID 174857893) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;methyl 3-hydroxy-2-methylidenebutanoate.
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;methyl 3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 174857893 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;methyl 3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC)C(C)O.CC(C)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2.C6H10O3/c1-4(2)3-5(7)6(8)9;1-4(5(2)7)6(8)9-3/h4-5H,3,7H2,1-2H3,(H,8,9);5,7H,1H2,2-3H3/t5-;/m0./s1 |
| InChIKey | DGKDJPIQDWRBHD-JEDNCBNOSA-N |
| XLogP | 0.54 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|