About copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate
copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate (PubChem CID 174858788) has the molecular formula C22H39CuO4
and a molecular weight of 431.10 g/mol. Its IUPAC name is copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate |
| PubChem CID | 174858788 |
| Molecular Formula | C22H39CuO4 |
| Molecular Weight | 431.10 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate |
| SMILES | C=CC(=O)OC.CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Cu+] |
| InChI | InChI=1S/C18H34O2.C4H6O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4(5)6-2;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3H,1H2,2H3;/q;;+1/p-1/b10-9-;; |
| InChIKey | JDIWXQFEUWYUTF-XXAVUKJNSA-M |
| XLogP | 5.12 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.10 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate?
The IUPAC name of copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate (CID 174858788) is copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate.
What is the SMILES notation for copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate?
The canonical SMILES for copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate is C=CC(=O)OC.CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[Cu+].
What is the InChIKey of copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate?
The InChIKey is JDIWXQFEUWYUTF-XXAVUKJNSA-M. The full InChI is InChI=1S/C18H34O2.C4H6O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4(5)6-2;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3H,1H2,2H3;/q;;+1/p-1/b10-9-;;.
What are the key properties of copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate?
copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate has a molecular weight of 431.10 g/mol, XLogP of 5.12, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);methyl prop-2-enoate;(Z)-octadec-9-enoate is sourced from PubChem (CID 174858788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).