C21H20N4OS — CID 17485885
N-cyclopropyl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanamide (PubChem CID 17485885) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is N-cyclopropyl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanamide.
| Compound Name | N-cyclopropyl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 17485885 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-cyclopropyl-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)NC1CC1 |
| InChI | InChI=1S/C21H20N4OS/c1-14(20(26)22-17-12-13-17)27-21-23-18(15-8-4-2-5-9-15)19(24-25-21)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3,(H,22,26) |
| InChIKey | YMBZEAXNTUDMNS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |