C25H20N4O3S — CID 23998326
3-[2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanoylamino]benzoic acid (PubChem CID 23998326) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-[2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanoylamino]benzoic acid.
| Compound Name | 3-[2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 23998326 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3-[2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]propanoylamino]benzoic acid |
| SMILES | CC(Sc1nnc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H20N4O3S/c1-16(23(30)26-20-14-8-13-19(15-20)24(31)32)33-25-27-21(17-9-4-2-5-10-17)22(28-29-25)18-11-6-3-7-12-18/h2-16H,1H3,(H,26,30)(H,31,32) |
| InChIKey | FFIORSIQKJRXPR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |