About fluoroform;1-hexyl-2-methylimidazole
fluoroform;1-hexyl-2-methylimidazole (PubChem CID 174860235) has the molecular formula C11H19F3N2
and a molecular weight of 236.28 g/mol. Its IUPAC name is fluoroform;1-hexyl-2-methylimidazole.
Molecular Properties
| Compound Name | fluoroform;1-hexyl-2-methylimidazole |
| PubChem CID | 174860235 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | fluoroform;1-hexyl-2-methylimidazole |
| SMILES | CCCCCCn1ccnc1C.FC(F)F |
| InChI | InChI=1S/C10H18N2.CHF3/c1-3-4-5-6-8-12-9-7-11-10(12)2;2-1(3)4/h7,9H,3-6,8H2,1-2H3;1H |
| InChIKey | BBSJLRQOVVHWKM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;1-hexyl-2-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;1-hexyl-2-methylimidazole?
The IUPAC name of fluoroform;1-hexyl-2-methylimidazole (CID 174860235) is fluoroform;1-hexyl-2-methylimidazole.
What is the SMILES notation for fluoroform;1-hexyl-2-methylimidazole?
The canonical SMILES for fluoroform;1-hexyl-2-methylimidazole is CCCCCCn1ccnc1C.FC(F)F.
What is the InChIKey of fluoroform;1-hexyl-2-methylimidazole?
The InChIKey is BBSJLRQOVVHWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2.CHF3/c1-3-4-5-6-8-12-9-7-11-10(12)2;2-1(3)4/h7,9H,3-6,8H2,1-2H3;1H.
What are the key properties of fluoroform;1-hexyl-2-methylimidazole?
fluoroform;1-hexyl-2-methylimidazole has a molecular weight of 236.28 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;1-hexyl-2-methylimidazole is sourced from PubChem (CID 174860235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).