About 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide
1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide (PubChem CID 175335036) has the molecular formula C18H31IN6
and a molecular weight of 458.39 g/mol. Its IUPAC name is 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide.
Molecular Properties
| Compound Name | 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide |
| PubChem CID | 175335036 |
| Molecular Formula | C18H31IN6 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide |
| SMILES | CCCCCCn1ccnc1C.Cn1ccnc1.Cn1ccnc1.I |
| InChI | InChI=1S/C10H18N2.2C4H6N2.HI/c1-3-4-5-6-8-12-9-7-11-10(12)2;2*1-6-3-2-5-4-6;/h7,9H,3-6,8H2,1-2H3;2*2-4H,1H3;1H |
| InChIKey | MJTMFMVZBSRYTG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide?
The IUPAC name of 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide (CID 175335036) is 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide.
What is the SMILES notation for 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide?
The canonical SMILES for 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide is CCCCCCn1ccnc1C.Cn1ccnc1.Cn1ccnc1.I.
What is the InChIKey of 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide?
The InChIKey is MJTMFMVZBSRYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2.2C4H6N2.HI/c1-3-4-5-6-8-12-9-7-11-10(12)2;2*1-6-3-2-5-4-6;/h7,9H,3-6,8H2,1-2H3;2*2-4H,1H3;1H.
What are the key properties of 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide?
1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide has a molecular weight of 458.39 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-2-methylimidazole;bis(1-methylimidazole);hydroiodide is sourced from PubChem (CID 175335036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).