C12H12N2O5S2 — CID 174861355
1-[(6R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]-2-(furan-2-yl)-2-oxoethanesulfinic acid (PubChem CID 174861355) has the molecular formula C12H12N2O5S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[(6R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]-2-(furan-2-yl)-2-oxoethanesulfinic acid.
| Compound Name | 1-[(6R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]-2-(furan-2-yl)-2-oxoethanesulfinic acid |
|---|---|
| PubChem CID | 174861355 |
| Molecular Formula | C12H12N2O5S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-[(6R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]-2-(furan-2-yl)-2-oxoethanesulfinic acid |
| SMILES | NC1C(=O)N2C=C(C(C(=O)c3ccco3)S(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C12H12N2O5S2/c13-8-11(16)14-4-6(5-20-12(8)14)10(21(17)18)9(15)7-2-1-3-19-7/h1-4,8,10,12H,5,13H2,(H,17,18)/t8?,10?,12-/m1/s1 |
| InChIKey | GEEXNBNZMBGPQP-HSLLBKHCSA-N |
| XLogP | 0.18 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|