C16H10F6N2 — CID 174861792
1,2,3,4,5,6-hexafluoro-2,3-diphenylpyrazine (PubChem CID 174861792) has the molecular formula C16H10F6N2 and a molecular weight of 344.26 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexafluoro-2,3-diphenylpyrazine.
| Compound Name | 1,2,3,4,5,6-hexafluoro-2,3-diphenylpyrazine |
|---|---|
| PubChem CID | 174861792 |
| Molecular Formula | C16H10F6N2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1,2,3,4,5,6-hexafluoro-2,3-diphenylpyrazine |
| SMILES | FC1=C(F)N(F)C(F)(c2ccccc2)C(F)(c2ccccc2)N1F |
| InChI | InChI=1S/C16H10F6N2/c17-13-14(18)24(22)16(20,12-9-5-2-6-10-12)15(19,23(13)21)11-7-3-1-4-8-11/h1-10H |
| InChIKey | LTQXLMXRRLTQLC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|