About naphthalene;(4-phosphanylphenyl)methanamine
naphthalene;(4-phosphanylphenyl)methanamine (PubChem CID 174862776) has the molecular formula C17H18NP
and a molecular weight of 267.31 g/mol. Its IUPAC name is naphthalene;(4-phosphanylphenyl)methanamine.
Molecular Properties
| Compound Name | naphthalene;(4-phosphanylphenyl)methanamine |
| PubChem CID | 174862776 |
| Molecular Formula | C17H18NP |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | naphthalene;(4-phosphanylphenyl)methanamine |
| SMILES | NCc1ccc(P)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C7H10NP/c1-2-6-10-8-4-3-7-9(10)5-1;8-5-6-1-3-7(9)4-2-6/h1-8H;1-4H,5,8-9H2 |
| InChIKey | WZIHVIAAURJQOP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;(4-phosphanylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;(4-phosphanylphenyl)methanamine?
The IUPAC name of naphthalene;(4-phosphanylphenyl)methanamine (CID 174862776) is naphthalene;(4-phosphanylphenyl)methanamine.
What is the SMILES notation for naphthalene;(4-phosphanylphenyl)methanamine?
The canonical SMILES for naphthalene;(4-phosphanylphenyl)methanamine is NCc1ccc(P)cc1.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;(4-phosphanylphenyl)methanamine?
The InChIKey is WZIHVIAAURJQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C7H10NP/c1-2-6-10-8-4-3-7-9(10)5-1;8-5-6-1-3-7(9)4-2-6/h1-8H;1-4H,5,8-9H2.
What are the key properties of naphthalene;(4-phosphanylphenyl)methanamine?
naphthalene;(4-phosphanylphenyl)methanamine has a molecular weight of 267.31 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;(4-phosphanylphenyl)methanamine is sourced from PubChem (CID 174862776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).