C7H15N3 — CID 174864016
(2S)-1-azabicyclo[2.2.2]octane-2,3-diamine (PubChem CID 174864016) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is (2S)-1-azabicyclo[2.2.2]octane-2,3-diamine.
| Compound Name | (2S)-1-azabicyclo[2.2.2]octane-2,3-diamine |
|---|---|
| PubChem CID | 174864016 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (2S)-1-azabicyclo[2.2.2]octane-2,3-diamine |
| SMILES | NC1C2CCN(CC2)[C@@H]1N |
| InChI | InChI=1S/C7H15N3/c8-6-5-1-3-10(4-2-5)7(6)9/h5-7H,1-4,8-9H2/t6?,7-/m0/s1 |
| InChIKey | IZPFCAWGYKPHQH-MLWJPKLSSA-N |
| XLogP | -0.68 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |