C8H16N2O3 — CID 85195122
8-amino-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol (PubChem CID 85195122) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 8-amino-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol.
| Compound Name | 8-amino-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol |
|---|---|
| PubChem CID | 85195122 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 8-amino-1,2,3,5,6,7,8,8a-octahydroindolizine-1,6,7-triol |
| SMILES | NC1C(O)C(O)CN2CCC(O)C12 |
| InChI | InChI=1S/C8H16N2O3/c9-6-7-4(11)1-2-10(7)3-5(12)8(6)13/h4-8,11-13H,1-3,9H2 |
| InChIKey | DGNLZGBUNJKCFU-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |