C7H13NO3 — CID 153057468
(2R,7R,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol (PubChem CID 153057468) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2R,7R,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol.
| Compound Name | (2R,7R,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
|---|---|
| PubChem CID | 153057468 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2R,7R,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
| SMILES | OC1[C@H](O)CN2CC[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C7H13NO3/c9-4-1-2-8-3-5(10)7(11)6(4)8/h4-7,9-11H,1-3H2/t4-,5-,6-,7?/m1/s1 |
| InChIKey | VITWQXFCXWSTHM-RKEPMNIXSA-N |
| XLogP | -1.84 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |