C6H9FN2O3 — CID 174864585
3-carbamoyl-4-fluoropyrrolidine-1-carboxylic acid (PubChem CID 174864585) has the molecular formula C6H9FN2O3 and a molecular weight of 176.15 g/mol. Its IUPAC name is 3-carbamoyl-4-fluoropyrrolidine-1-carboxylic acid.
| Compound Name | 3-carbamoyl-4-fluoropyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174864585 |
| Molecular Formula | C6H9FN2O3 |
| Molecular Weight | 176.15 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-carbamoyl-4-fluoropyrrolidine-1-carboxylic acid |
| SMILES | NC(=O)C1CN(C(=O)O)CC1F |
| InChI | InChI=1S/C6H9FN2O3/c7-4-2-9(6(11)12)1-3(4)5(8)10/h3-4H,1-2H2,(H2,8,10)(H,11,12) |
| InChIKey | KJHJXLRITJCPES-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.15 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |