C7H10N2O2S — CID 129052499
(1R,5S)-6-carbamothioyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 129052499) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is (1R,5S)-6-carbamothioyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | (1R,5S)-6-carbamothioyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 129052499 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (1R,5S)-6-carbamothioyl-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | NC(=S)C1[C@H]2CN(C(=O)O)C[C@@H]12 |
| InChI | InChI=1S/C7H10N2O2S/c8-6(12)5-3-1-9(7(10)11)2-4(3)5/h3-5H,1-2H2,(H2,8,12)(H,10,11)/t3-,4+,5? |
| InChIKey | YMTXQCXMUPPKMW-NGQZWQHPSA-N |
| XLogP | 0.13 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|