C9H11N3O4 — CID 174864646
6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid (PubChem CID 174864646) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid.
| Compound Name | 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid |
|---|---|
| PubChem CID | 174864646 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid |
| SMILES | Nc1ccc(C(=O)O)c(C2CC2)n1.O=NO |
| InChI | InChI=1S/C9H10N2O2.HNO2/c10-7-4-3-6(9(12)13)8(11-7)5-1-2-5;2-1-3/h3-5H,1-2H2,(H2,10,11)(H,12,13);(H,2,3) |
| InChIKey | WHMSDBLQAOUYKY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|