About 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid
6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid (PubChem CID 174864646) has the molecular formula C9H11N3O4
and a molecular weight of 225.20 g/mol. Its IUPAC name is 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid.
Molecular Properties
| Compound Name | 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid |
| PubChem CID | 174864646 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid |
| SMILES | Nc1ccc(C(=O)O)c(C2CC2)n1.O=NO |
| InChI | InChI=1S/C9H10N2O2.HNO2/c10-7-4-3-6(9(12)13)8(11-7)5-1-2-5;2-1-3/h3-5H,1-2H2,(H2,10,11)(H,12,13);(H,2,3) |
| InChIKey | WHMSDBLQAOUYKY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid?
The IUPAC name of 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid (CID 174864646) is 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid.
What is the SMILES notation for 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid?
The canonical SMILES for 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid is Nc1ccc(C(=O)O)c(C2CC2)n1.O=NO.
What is the InChIKey of 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid?
The InChIKey is WHMSDBLQAOUYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2.HNO2/c10-7-4-3-6(9(12)13)8(11-7)5-1-2-5;2-1-3/h3-5H,1-2H2,(H2,10,11)(H,12,13);(H,2,3).
What are the key properties of 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid?
6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid has a molecular weight of 225.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-cyclopropylpyridine-3-carboxylic acid;nitrous acid is sourced from PubChem (CID 174864646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).