C6H9N3S3 — CID 174864959
N'-(3-methanethioyl-1,2,4-dithiazol-3-yl)-N,N-dimethylmethanimidamide (PubChem CID 174864959) has the molecular formula C6H9N3S3 and a molecular weight of 219.36 g/mol. Its IUPAC name is N'-(3-methanethioyl-1,2,4-dithiazol-3-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3-methanethioyl-1,2,4-dithiazol-3-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 174864959 |
| Molecular Formula | C6H9N3S3 |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | N'-(3-methanethioyl-1,2,4-dithiazol-3-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NC1(C=S)N=CSS1 |
| InChI | InChI=1S/C6H9N3S3/c1-9(2)4-7-6(3-10)8-5-11-12-6/h3-5H,1-2H3 |
| InChIKey | MYHDNOBGLAQQCP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|