C6H9N3S2 — CID 146952875
N,N-dimethyl-N'-(4-sulfanylidene-1,3-thiazol-2-yl)methanimidamide (PubChem CID 146952875) has the molecular formula C6H9N3S2 and a molecular weight of 187.29 g/mol. Its IUPAC name is N,N-dimethyl-N'-(4-sulfanylidene-1,3-thiazol-2-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(4-sulfanylidene-1,3-thiazol-2-yl)methanimidamide |
|---|---|
| PubChem CID | 146952875 |
| Molecular Formula | C6H9N3S2 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | N,N-dimethyl-N'-(4-sulfanylidene-1,3-thiazol-2-yl)methanimidamide |
| SMILES | CN(C)C=NC1=NC(=S)CS1 |
| InChI | InChI=1S/C6H9N3S2/c1-9(2)4-7-6-8-5(10)3-11-6/h4H,3H2,1-2H3 |
| InChIKey | AJBJUNBUUJZLQU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|