C5H8N2S2 — CID 45118439
3-methyl-2-methylimino-1,3-thiazolidine-4-thione (PubChem CID 45118439) has the molecular formula C5H8N2S2 and a molecular weight of 160.27 g/mol. Its IUPAC name is 3-methyl-2-methylimino-1,3-thiazolidine-4-thione.
| Compound Name | 3-methyl-2-methylimino-1,3-thiazolidine-4-thione |
|---|---|
| PubChem CID | 45118439 |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 3-methyl-2-methylimino-1,3-thiazolidine-4-thione |
| SMILES | C/N=C1\SCC(=S)N1C |
| InChI | InChI=1S/C5H8N2S2/c1-6-5-7(2)4(8)3-9-5/h3H2,1-2H3/b6-5- |
| InChIKey | MFSDWYTXWQVBCO-WAYWQWQTSA-N |
| XLogP | 0.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|