C10H19N5 — CID 174868369
2,2-dimethylpiperazine;pyrimidin-2-amine (PubChem CID 174868369) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2,2-dimethylpiperazine;pyrimidin-2-amine.
| Compound Name | 2,2-dimethylpiperazine;pyrimidin-2-amine |
|---|---|
| PubChem CID | 174868369 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2,2-dimethylpiperazine;pyrimidin-2-amine |
| SMILES | CC1(C)CNCCN1.Nc1ncccn1 |
| InChI | InChI=1S/C6H14N2.C4H5N3/c1-6(2)5-7-3-4-8-6;5-4-6-2-1-3-7-4/h7-8H,3-5H2,1-2H3;1-3H,(H2,5,6,7) |
| InChIKey | CYQKHRRSRHTHNL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |