C21H34O4Si — CID 174868783
tert-butyl-hydroxy-dimethylsilane;methyl 5-(phenylmethoxymethyl)cyclopentene-1-carboxylate (PubChem CID 174868783) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is tert-butyl-hydroxy-dimethylsilane;methyl 5-(phenylmethoxymethyl)cyclopentene-1-carboxylate.
| Compound Name | tert-butyl-hydroxy-dimethylsilane;methyl 5-(phenylmethoxymethyl)cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 174868783 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl-hydroxy-dimethylsilane;methyl 5-(phenylmethoxymethyl)cyclopentene-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O.COC(=O)C1=CCCC1COCc1ccccc1 |
| InChI | InChI=1S/C15H18O3.C6H16OSi/c1-17-15(16)14-9-5-8-13(14)11-18-10-12-6-3-2-4-7-12;1-6(2,3)8(4,5)7/h2-4,6-7,9,13H,5,8,10-11H2,1H3;7H,1-5H3 |
| InChIKey | QYYVGEPIRFWPKX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|