About 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide
4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide (PubChem CID 174870559) has the molecular formula C10H22BrNS
and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide.
Molecular Properties
| Compound Name | 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide |
| PubChem CID | 174870559 |
| Molecular Formula | C10H22BrNS |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide |
| SMILES | Br.CN1CCCCC1CCCCS |
| InChI | InChI=1S/C10H21NS.BrH/c1-11-8-4-2-6-10(11)7-3-5-9-12;/h10,12H,2-9H2,1H3;1H |
| InChIKey | PPHYKTPKXCOSTM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide?
The IUPAC name of 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide (CID 174870559) is 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide.
What is the SMILES notation for 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide?
The canonical SMILES for 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide is Br.CN1CCCCC1CCCCS.
What is the InChIKey of 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide?
The InChIKey is PPHYKTPKXCOSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NS.BrH/c1-11-8-4-2-6-10(11)7-3-5-9-12;/h10,12H,2-9H2,1H3;1H.
What are the key properties of 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide?
4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide has a molecular weight of 268.26 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylpiperidin-2-yl)butane-1-thiol;hydrobromide is sourced from PubChem (CID 174870559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).