About cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene
cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene (PubChem CID 174872348) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene |
| PubChem CID | 174872348 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene |
| SMILES | C1=CCCC1.C=CC12C=CC(CC1)C2 |
| InChI | InChI=1S/C9H12.C5H8/c1-2-9-5-3-8(7-9)4-6-9;1-2-4-5-3-1/h2-3,5,8H,1,4,6-7H2;1-2H,3-5H2 |
| InChIKey | BYZFVELKWRTYMN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene?
The IUPAC name of cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene (CID 174872348) is cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene?
The canonical SMILES for cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene is C1=CCCC1.C=CC12C=CC(CC1)C2.
What is the InChIKey of cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene?
The InChIKey is BYZFVELKWRTYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C5H8/c1-2-9-5-3-8(7-9)4-6-9;1-2-4-5-3-1/h2-3,5,8H,1,4,6-7H2;1-2H,3-5H2.
What are the key properties of cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene?
cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene has a molecular weight of 188.31 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentene;1-ethenylbicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 174872348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).