About 4-phenyl-2H-triazole;thiophene
4-phenyl-2H-triazole;thiophene (PubChem CID 174873348) has the molecular formula C12H11N3S
and a molecular weight of 229.31 g/mol. Its IUPAC name is 4-phenyl-2H-triazole;thiophene.
Molecular Properties
| Compound Name | 4-phenyl-2H-triazole;thiophene |
| PubChem CID | 174873348 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-phenyl-2H-triazole;thiophene |
| SMILES | c1ccc(-c2cn[nH]n2)cc1.c1ccsc1 |
| InChI | InChI=1S/C8H7N3.C4H4S/c1-2-4-7(5-3-1)8-6-9-11-10-8;1-2-4-5-3-1/h1-6H,(H,9,10,11);1-4H |
| InChIKey | FGZAHAYINGYNDT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-2H-triazole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2H-triazole;thiophene?
The IUPAC name of 4-phenyl-2H-triazole;thiophene (CID 174873348) is 4-phenyl-2H-triazole;thiophene.
What is the SMILES notation for 4-phenyl-2H-triazole;thiophene?
The canonical SMILES for 4-phenyl-2H-triazole;thiophene is c1ccc(-c2cn[nH]n2)cc1.c1ccsc1.
What is the InChIKey of 4-phenyl-2H-triazole;thiophene?
The InChIKey is FGZAHAYINGYNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C4H4S/c1-2-4-7(5-3-1)8-6-9-11-10-8;1-2-4-5-3-1/h1-6H,(H,9,10,11);1-4H.
What are the key properties of 4-phenyl-2H-triazole;thiophene?
4-phenyl-2H-triazole;thiophene has a molecular weight of 229.31 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2H-triazole;thiophene is sourced from PubChem (CID 174873348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).