About 1,1'-biphenyl;sulfur dioxide;thiophene
1,1'-biphenyl;sulfur dioxide;thiophene (PubChem CID 174331711) has the molecular formula C16H14O2S2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 1,1'-biphenyl;sulfur dioxide;thiophene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;sulfur dioxide;thiophene |
| PubChem CID | 174331711 |
| Molecular Formula | C16H14O2S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1,1'-biphenyl;sulfur dioxide;thiophene |
| SMILES | O=S=O.c1ccc(-c2ccccc2)cc1.c1ccsc1 |
| InChI | InChI=1S/C12H10.C4H4S.O2S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-5-3-1;1-3-2/h1-10H;1-4H; |
| InChIKey | ZQFYPDYEEQGPQH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1'-biphenyl;sulfur dioxide;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;sulfur dioxide;thiophene?
The IUPAC name of 1,1'-biphenyl;sulfur dioxide;thiophene (CID 174331711) is 1,1'-biphenyl;sulfur dioxide;thiophene.
What is the SMILES notation for 1,1'-biphenyl;sulfur dioxide;thiophene?
The canonical SMILES for 1,1'-biphenyl;sulfur dioxide;thiophene is O=S=O.c1ccc(-c2ccccc2)cc1.c1ccsc1.
What is the InChIKey of 1,1'-biphenyl;sulfur dioxide;thiophene?
The InChIKey is ZQFYPDYEEQGPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C4H4S.O2S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-5-3-1;1-3-2/h1-10H;1-4H;.
What are the key properties of 1,1'-biphenyl;sulfur dioxide;thiophene?
1,1'-biphenyl;sulfur dioxide;thiophene has a molecular weight of 302.42 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;sulfur dioxide;thiophene is sourced from PubChem (CID 174331711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).