About 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol
1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol (PubChem CID 174873794) has the molecular formula C8H22N2O4S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol.
Molecular Properties
| Compound Name | 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol |
| PubChem CID | 174873794 |
| Molecular Formula | C8H22N2O4S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol |
| SMILES | CCC(N)S(=O)(=O)O.CN(C)CCCO |
| InChI | InChI=1S/C5H13NO.C3H9NO3S/c1-6(2)4-3-5-7;1-2-3(4)8(5,6)7/h7H,3-5H2,1-2H3;3H,2,4H2,1H3,(H,5,6,7) |
| InChIKey | YOLFIBLPNYPZTG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol?
The IUPAC name of 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol (CID 174873794) is 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol.
What is the SMILES notation for 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol?
The canonical SMILES for 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol is CCC(N)S(=O)(=O)O.CN(C)CCCO.
What is the InChIKey of 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol?
The InChIKey is YOLFIBLPNYPZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO.C3H9NO3S/c1-6(2)4-3-5-7;1-2-3(4)8(5,6)7/h7H,3-5H2,1-2H3;3H,2,4H2,1H3,(H,5,6,7).
What are the key properties of 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol?
1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol has a molecular weight of 242.34 g/mol, XLogP of -0.50, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropane-1-sulfonic acid;3-(dimethylamino)propan-1-ol is sourced from PubChem (CID 174873794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).