C19H18FN3OS — CID 17487470
N-(2-ethylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 17487470) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(2-ethylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 17487470 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(2-ethylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | CCc1ccccc1NC(=O)CSc1nccn1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H18FN3OS/c1-2-14-6-3-4-9-17(14)22-18(24)13-25-19-21-10-11-23(19)16-8-5-7-15(20)12-16/h3-12H,2,13H2,1H3,(H,22,24) |
| InChIKey | UXUCTDPEBNJLCF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |