C18H15BrFN3OS — CID 30063099
N-(2-bromo-4-methylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 30063099) has the molecular formula C18H15BrFN3OS and a molecular weight of 420.31 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 30063099 |
| Molecular Formula | C18H15BrFN3OS |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nccn2-c2cccc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C18H15BrFN3OS/c1-12-5-6-16(15(19)9-12)22-17(24)11-25-18-21-7-8-23(18)14-4-2-3-13(20)10-14/h2-10H,11H2,1H3,(H,22,24) |
| InChIKey | ITHZZYGSXGHFJG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |