About (4-aminocuban-1-yl) acetate;hydrochloride
(4-aminocuban-1-yl) acetate;hydrochloride (PubChem CID 174876114) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is (4-aminocuban-1-yl) acetate;hydrochloride.
Molecular Properties
| Compound Name | (4-aminocuban-1-yl) acetate;hydrochloride |
| PubChem CID | 174876114 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (4-aminocuban-1-yl) acetate;hydrochloride |
| SMILES | CC(=O)OC12C3C4C1C1C2C3C41N.Cl |
| InChI | InChI=1S/C10H11NO2.ClH/c1-2(12)13-10-6-3-7(10)5-8(10)4(6)9(3,5)11;/h3-8H,11H2,1H3;1H |
| InChIKey | NHQQKMIAPJCJES-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-aminocuban-1-yl) acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminocuban-1-yl) acetate;hydrochloride?
The IUPAC name of (4-aminocuban-1-yl) acetate;hydrochloride (CID 174876114) is (4-aminocuban-1-yl) acetate;hydrochloride.
What is the SMILES notation for (4-aminocuban-1-yl) acetate;hydrochloride?
The canonical SMILES for (4-aminocuban-1-yl) acetate;hydrochloride is CC(=O)OC12C3C4C1C1C2C3C41N.Cl.
What is the InChIKey of (4-aminocuban-1-yl) acetate;hydrochloride?
The InChIKey is NHQQKMIAPJCJES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.ClH/c1-2(12)13-10-6-3-7(10)5-8(10)4(6)9(3,5)11;/h3-8H,11H2,1H3;1H.
What are the key properties of (4-aminocuban-1-yl) acetate;hydrochloride?
(4-aminocuban-1-yl) acetate;hydrochloride has a molecular weight of 213.66 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminocuban-1-yl) acetate;hydrochloride is sourced from PubChem (CID 174876114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).