C13H13Br3O2 — CID 99844933
[(1S,2R,3R,5R,6S,8S,9S,10R,11R)-7,7,11-tribromo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl] acetate (PubChem CID 99844933) has the molecular formula C13H13Br3O2 and a molecular weight of 440.96 g/mol. Its IUPAC name is [(1S,2R,3R,5R,6S,8S,9S,10R,11R)-7,7,11-tribromo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl] acetate.
| Compound Name | [(1S,2R,3R,5R,6S,8S,9S,10R,11R)-7,7,11-tribromo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl] acetate |
|---|---|
| PubChem CID | 99844933 |
| Molecular Formula | C13H13Br3O2 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 437.85 |
| IUPAC Name | [(1S,2R,3R,5R,6S,8S,9S,10R,11R)-7,7,11-tribromo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl] acetate |
| SMILES | CC(=O)O[C@]12[C@@H]3[C@H]4C[C@@H]5[C@@H]([C@@H]4[C@H]1Br)[C@@H]2C(Br)(Br)[C@@H]53 |
| InChI | InChI=1S/C13H13Br3O2/c1-3(17)18-12-8-5-2-4-6(7(5)11(12)14)10(12)13(15,16)9(4)8/h4-11H,2H2,1H3/t4-,5+,6+,7-,8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | ZEDFRXCPHNEQQN-XPMHZCIGSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|