C11H22ClNO3 — CID 174876627
(2E,4E)-hexa-2,4-dienoic acid;2-hydroxyethyl(trimethyl)azanium;chloride (PubChem CID 174876627) has the molecular formula C11H22ClNO3 and a molecular weight of 251.75 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienoic acid;2-hydroxyethyl(trimethyl)azanium;chloride.
| Compound Name | (2E,4E)-hexa-2,4-dienoic acid;2-hydroxyethyl(trimethyl)azanium;chloride |
|---|---|
| PubChem CID | 174876627 |
| Molecular Formula | C11H22ClNO3 |
| Molecular Weight | 251.75 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienoic acid;2-hydroxyethyl(trimethyl)azanium;chloride |
| SMILES | C/C=C/C=C/C(=O)O.C[N+](C)(C)CCO.[Cl-] |
| InChI | InChI=1S/C6H8O2.C5H14NO.ClH/c1-2-3-4-5-6(7)8;1-6(2,3)4-5-7;/h2-5H,1H3,(H,7,8);7H,4-5H2,1-3H3;1H/q;+1;/p-1/b3-2+,5-4+;; |
| InChIKey | CFPZSABWTBWNRJ-IOUXFWSCSA-M |
| XLogP | -2.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.75 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|