C16H11F3N2O2 — CID 174880442
N-(4-methoxyphenyl)-3-(2,4,5-trifluorophenyl)-1,2-oxazol-5-amine (PubChem CID 174880442) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-(2,4,5-trifluorophenyl)-1,2-oxazol-5-amine.
| Compound Name | N-(4-methoxyphenyl)-3-(2,4,5-trifluorophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 174880442 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(4-methoxyphenyl)-3-(2,4,5-trifluorophenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(Nc2cc(-c3cc(F)c(F)cc3F)no2)cc1 |
| InChI | InChI=1S/C16H11F3N2O2/c1-22-10-4-2-9(3-5-10)20-16-8-15(21-23-16)11-6-13(18)14(19)7-12(11)17/h2-8,20H,1H3 |
| InChIKey | FKOCMJYXHIJOIP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|