C16H13F2N3O3 — CID 135476481
6,7-difluoro-N-(4-methoxyphenyl)-3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-amine (PubChem CID 135476481) has the molecular formula C16H13F2N3O3 and a molecular weight of 333.29 g/mol. Its IUPAC name is 6,7-difluoro-N-(4-methoxyphenyl)-3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-amine.
| Compound Name | 6,7-difluoro-N-(4-methoxyphenyl)-3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-amine |
|---|---|
| PubChem CID | 135476481 |
| Molecular Formula | C16H13F2N3O3 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 6,7-difluoro-N-(4-methoxyphenyl)-3-methyl-1,4-dioxidoquinoxaline-1,4-diium-2-amine |
| SMILES | COc1ccc(Nc2c(C)[n+]([O-])c3cc(F)c(F)cc3[n+]2[O-])cc1 |
| InChI | InChI=1S/C16H13F2N3O3/c1-9-16(19-10-3-5-11(24-2)6-4-10)21(23)15-8-13(18)12(17)7-14(15)20(9)22/h3-8,19H,1-2H3 |
| InChIKey | MAPFMDXCUDPWNR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|