C17H32O5 — CID 174881154
ethane-1,2-diol;pentadecane-6,8,10-trione (PubChem CID 174881154) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethane-1,2-diol;pentadecane-6,8,10-trione.
| Compound Name | ethane-1,2-diol;pentadecane-6,8,10-trione |
|---|---|
| PubChem CID | 174881154 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | ethane-1,2-diol;pentadecane-6,8,10-trione |
| SMILES | CCCCCC(=O)CC(=O)CC(=O)CCCCC.OCCO |
| InChI | InChI=1S/C15H26O3.C2H6O2/c1-3-5-7-9-13(16)11-15(18)12-14(17)10-8-6-4-2;3-1-2-4/h3-12H2,1-2H3;3-4H,1-2H2 |
| InChIKey | KCWWQQKLJIIFNW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|