C14H16N2O2 — CID 174881923
5-methylpyrazine-2-carboxylic acid;1,4-xylene (PubChem CID 174881923) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-methylpyrazine-2-carboxylic acid;1,4-xylene.
| Compound Name | 5-methylpyrazine-2-carboxylic acid;1,4-xylene |
|---|---|
| PubChem CID | 174881923 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 5-methylpyrazine-2-carboxylic acid;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C8H10.C6H6N2O2/c1-7-3-5-8(2)6-4-7;1-4-2-8-5(3-7-4)6(9)10/h3-6H,1-2H3;2-3H,1H3,(H,9,10) |
| InChIKey | VWLWRICOIUPGDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |