About 5-methylpyrazine-2-carboxylic acid;1,4-xylene
5-methylpyrazine-2-carboxylic acid;1,4-xylene (PubChem CID 174881923) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-methylpyrazine-2-carboxylic acid;1,4-xylene.
Molecular Properties
| Compound Name | 5-methylpyrazine-2-carboxylic acid;1,4-xylene |
| PubChem CID | 174881923 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 5-methylpyrazine-2-carboxylic acid;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C8H10.C6H6N2O2/c1-7-3-5-8(2)6-4-7;1-4-2-8-5(3-7-4)6(9)10/h3-6H,1-2H3;2-3H,1H3,(H,9,10) |
| InChIKey | VWLWRICOIUPGDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylpyrazine-2-carboxylic acid;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrazine-2-carboxylic acid;1,4-xylene?
The IUPAC name of 5-methylpyrazine-2-carboxylic acid;1,4-xylene (CID 174881923) is 5-methylpyrazine-2-carboxylic acid;1,4-xylene.
What is the SMILES notation for 5-methylpyrazine-2-carboxylic acid;1,4-xylene?
The canonical SMILES for 5-methylpyrazine-2-carboxylic acid;1,4-xylene is Cc1ccc(C)cc1.Cc1cnc(C(=O)O)cn1.
What is the InChIKey of 5-methylpyrazine-2-carboxylic acid;1,4-xylene?
The InChIKey is VWLWRICOIUPGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C6H6N2O2/c1-7-3-5-8(2)6-4-7;1-4-2-8-5(3-7-4)6(9)10/h3-6H,1-2H3;2-3H,1H3,(H,9,10).
What are the key properties of 5-methylpyrazine-2-carboxylic acid;1,4-xylene?
5-methylpyrazine-2-carboxylic acid;1,4-xylene has a molecular weight of 244.29 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrazine-2-carboxylic acid;1,4-xylene is sourced from PubChem (CID 174881923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).