C14H17Cl2NO2 — CID 174882059
2-cyclohexyl-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 174882059) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | 2-cyclohexyl-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 174882059 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-cyclohexyl-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | NC(=O)C(Oc1ccc(Cl)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H17Cl2NO2/c15-10-6-7-12(11(16)8-10)19-13(14(17)18)9-4-2-1-3-5-9/h6-9,13H,1-5H2,(H2,17,18) |
| InChIKey | NIFCSFFKOVBBMA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |