C11H9F2NO3 — CID 174883761
1-carbamoyl-2,3-difluoro-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 174883761) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is 1-carbamoyl-2,3-difluoro-2-phenylcyclopropane-1-carboxylic acid.
| Compound Name | 1-carbamoyl-2,3-difluoro-2-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 174883761 |
| Molecular Formula | C11H9F2NO3 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1-carbamoyl-2,3-difluoro-2-phenylcyclopropane-1-carboxylic acid |
| SMILES | NC(=O)C1(C(=O)O)C(F)C1(F)c1ccccc1 |
| InChI | InChI=1S/C11H9F2NO3/c12-7-10(8(14)15,9(16)17)11(7,13)6-4-2-1-3-5-6/h1-5,7H,(H2,14,15)(H,16,17) |
| InChIKey | PKKRZAUBBRWYLL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|