C25H37N3O6 — CID 174884149
benzene-1,2,4-tricarboxylic acid;1-(2-undecyl-1H-imidazol-5-yl)ethanamine (PubChem CID 174884149) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;1-(2-undecyl-1H-imidazol-5-yl)ethanamine.
| Compound Name | benzene-1,2,4-tricarboxylic acid;1-(2-undecyl-1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 174884149 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;1-(2-undecyl-1H-imidazol-5-yl)ethanamine |
| SMILES | CCCCCCCCCCCc1ncc(C(C)N)[nH]1.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H31N3.C9H6O6/c1-3-4-5-6-7-8-9-10-11-12-16-18-13-15(19-16)14(2)17;10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h13-14H,3-12,17H2,1-2H3,(H,18,19);1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | KZGSVCCORGHDSF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 166.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|